C28H51N2O7Si+ — CID 174038763
trimethyl-[2-[2-[2-[4-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-silylpropyl]phenoxy]ethoxy]ethoxy]ethyl]azanium (PubChem CID 174038763) has the molecular formula C28H51N2O7Si+ and a molecular weight of 555.81 g/mol. Its IUPAC name is trimethyl-[2-[2-[2-[4-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-silylpropyl]phenoxy]ethoxy]ethoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[2-[2-[4-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-silylpropyl]phenoxy]ethoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 174038763 |
| Molecular Formula | C28H51N2O7Si+ |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 555.35 |
| IUPAC Name | trimethyl-[2-[2-[2-[4-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-silylpropyl]phenoxy]ethoxy]ethoxy]ethyl]azanium |
| SMILES | CC(C)(C)OC(=O)NC([SiH3])[C@@H](Cc1ccc(OCCOCCOCC[N+](C)(C)C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H50N2O7Si/c1-27(2,3)36-25(31)23(24(38)29-26(32)37-28(4,5)6)20-21-10-12-22(13-11-21)35-19-18-34-17-16-33-15-14-30(7,8)9/h10-13,23-24H,14-20H2,1-9,38H3/p+1/t23-,24?/m1/s1 |
| InChIKey | NETLBJLQVCQXAI-MIHMCVIASA-O |
| XLogP | 2.52 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|