C22H37NO8 — CID 144767912
tert-butyl N-[1-[4-[2-[2-[2-(2-methoxyethylperoxy)ethoxy]ethoxy]ethoxy]phenyl]ethyl]carbamate (PubChem CID 144767912) has the molecular formula C22H37NO8 and a molecular weight of 443.54 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[2-[2-[2-(2-methoxyethylperoxy)ethoxy]ethoxy]ethoxy]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[2-[2-[2-(2-methoxyethylperoxy)ethoxy]ethoxy]ethoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 144767912 |
| Molecular Formula | C22H37NO8 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | tert-butyl N-[1-[4-[2-[2-[2-(2-methoxyethylperoxy)ethoxy]ethoxy]ethoxy]phenyl]ethyl]carbamate |
| SMILES | COCCOOCCOCCOCCOc1ccc(C(C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H37NO8/c1-18(23-21(24)31-22(2,3)4)19-6-8-20(9-7-19)28-15-13-26-11-12-27-14-17-30-29-16-10-25-5/h6-9,18H,10-17H2,1-5H3,(H,23,24) |
| InChIKey | RMPNJROUCKCUIM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|