C17H27NO6S — CID 164592467
3-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]propyl methanesulfonate (PubChem CID 164592467) has the molecular formula C17H27NO6S and a molecular weight of 373.47 g/mol. Its IUPAC name is 3-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]propyl methanesulfonate.
| Compound Name | 3-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]propyl methanesulfonate |
|---|---|
| PubChem CID | 164592467 |
| Molecular Formula | C17H27NO6S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]propyl methanesulfonate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ccc(OCCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H27NO6S/c1-13(18-16(19)24-17(2,3)4)14-7-9-15(10-8-14)22-11-6-12-23-25(5,20)21/h7-10,13H,6,11-12H2,1-5H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | PVCPCKVPZBDUSM-ZDUSSCGKSA-N |
| XLogP | 3.02 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|