C12H19F3O4 — CID 113360241
dipropan-2-yl 2-(3,3,3-trifluoropropyl)propanedioate (PubChem CID 113360241) has the molecular formula C12H19F3O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is dipropan-2-yl 2-(3,3,3-trifluoropropyl)propanedioate.
| Compound Name | dipropan-2-yl 2-(3,3,3-trifluoropropyl)propanedioate |
|---|---|
| PubChem CID | 113360241 |
| Molecular Formula | C12H19F3O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | dipropan-2-yl 2-(3,3,3-trifluoropropyl)propanedioate |
| SMILES | CC(C)OC(=O)C(CCC(F)(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C12H19F3O4/c1-7(2)18-10(16)9(5-6-12(13,14)15)11(17)19-8(3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | HGRWGLQZIIIKIX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|