C10H11F3N2O4S — CID 67642786
2,3-diamino-3-[4-(trifluoromethyl)phenyl]sulfonylpropanoic acid (PubChem CID 67642786) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is 2,3-diamino-3-[4-(trifluoromethyl)phenyl]sulfonylpropanoic acid.
| Compound Name | 2,3-diamino-3-[4-(trifluoromethyl)phenyl]sulfonylpropanoic acid |
|---|---|
| PubChem CID | 67642786 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2,3-diamino-3-[4-(trifluoromethyl)phenyl]sulfonylpropanoic acid |
| SMILES | NC(C(=O)O)C(N)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O4S/c11-10(12,13)5-1-3-6(4-2-5)20(18,19)8(15)7(14)9(16)17/h1-4,7-8H,14-15H2,(H,16,17) |
| InChIKey | PLXNVZLSOPZUNJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |