C9H11ClN2O4S — CID 70070623
2,3-diamino-3-(2-chlorophenyl)sulfonylpropanoic acid (PubChem CID 70070623) has the molecular formula C9H11ClN2O4S and a molecular weight of 278.72 g/mol. Its IUPAC name is 2,3-diamino-3-(2-chlorophenyl)sulfonylpropanoic acid.
| Compound Name | 2,3-diamino-3-(2-chlorophenyl)sulfonylpropanoic acid |
|---|---|
| PubChem CID | 70070623 |
| Molecular Formula | C9H11ClN2O4S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2,3-diamino-3-(2-chlorophenyl)sulfonylpropanoic acid |
| SMILES | NC(C(=O)O)C(N)S(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C9H11ClN2O4S/c10-5-3-1-2-4-6(5)17(15,16)8(12)7(11)9(13)14/h1-4,7-8H,11-12H2,(H,13,14) |
| InChIKey | NMEVHRQLPLTSRP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |