C25H33NO6 — CID 4139968
[2-(2,6-diethylanilino)-2-oxoethyl] 3,4,5-triethoxybenzoate (PubChem CID 4139968) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 4139968 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)Nc2c(CC)cccc2CC)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H33NO6/c1-6-17-12-11-13-18(7-2)23(17)26-22(27)16-32-25(28)19-14-20(29-8-3)24(31-10-5)21(15-19)30-9-4/h11-15H,6-10,16H2,1-5H3,(H,26,27) |
| InChIKey | AXRLTEGLMGAIAP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |