C14H23NO7 — CID 58975704
diethyl 2-(4-acetyloxybutanoylamino)butanedioate (PubChem CID 58975704) has the molecular formula C14H23NO7 and a molecular weight of 317.34 g/mol. Its IUPAC name is diethyl 2-(4-acetyloxybutanoylamino)butanedioate.
| Compound Name | diethyl 2-(4-acetyloxybutanoylamino)butanedioate |
|---|---|
| PubChem CID | 58975704 |
| Molecular Formula | C14H23NO7 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | diethyl 2-(4-acetyloxybutanoylamino)butanedioate |
| SMILES | CCOC(=O)CC(NC(=O)CCCOC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C14H23NO7/c1-4-20-13(18)9-11(14(19)21-5-2)15-12(17)7-6-8-22-10(3)16/h11H,4-9H2,1-3H3,(H,15,17) |
| InChIKey | WWPFSMANAURYSN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|