C25H30N3O8P — CID 56969549
N-[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide (PubChem CID 56969549) has the molecular formula C25H30N3O8P and a molecular weight of 531.50 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide.
| Compound Name | N-[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 56969549 |
| Molecular Formula | C25H30N3O8P |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | N-[diethoxyphosphoryl-(4-methoxyphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)c1ccccc1Oc1nc(OC)cc(OC)n1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30N3O8P/c1-6-34-37(30,35-7-2)24(17-12-14-18(31-3)15-13-17)28-23(29)19-10-8-9-11-20(19)36-25-26-21(32-4)16-22(27-25)33-5/h8-16,24H,6-7H2,1-5H3,(H,28,29) |
| InChIKey | RNIBBYZOUOADLL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|