C17H16ClN3O2S2 — CID 17195694
2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 17195694) has the molecular formula C17H16ClN3O2S2 and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17195694 |
| Molecular Formula | C17H16ClN3O2S2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=S)NC(=O)/C=C/c2ccc(Cl)cc2)c(C(N)=O)c1C |
| InChI | InChI=1S/C17H16ClN3O2S2/c1-9-10(2)25-16(14(9)15(19)23)21-17(24)20-13(22)8-5-11-3-6-12(18)7-4-11/h3-8H,1-2H3,(H2,19,23)(H2,20,21,22,24)/b8-5+ |
| InChIKey | HVEOOPCKFOMMDG-VMPITWQZSA-N |
| XLogP | 3.64 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|