C19H18ClN3O2S2 — CID 17195673
2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17195673) has the molecular formula C19H18ClN3O2S2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17195673 |
| Molecular Formula | C19H18ClN3O2S2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=S)NC(=O)/C=C/c2ccc(Cl)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C19H18ClN3O2S2/c20-12-8-5-11(6-9-12)7-10-15(24)22-19(26)23-18-16(17(21)25)13-3-1-2-4-14(13)27-18/h5-10H,1-4H2,(H2,21,25)(H2,22,23,24,26)/b10-7+ |
| InChIKey | MCAGYWZVXVWKOA-JXMROGBWSA-N |
| XLogP | 3.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|