C17H14ClNO3S — CID 28860318
2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid (PubChem CID 28860318) has the molecular formula C17H14ClNO3S and a molecular weight of 347.82 g/mol. Its IUPAC name is 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid.
| Compound Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 28860318 |
| Molecular Formula | C17H14ClNO3S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Nc1sc2c(c1C(=O)O)CCC2 |
| InChI | InChI=1S/C17H14ClNO3S/c18-11-7-4-10(5-8-11)6-9-14(20)19-16-15(17(21)22)12-2-1-3-13(12)23-16/h4-9H,1-3H2,(H,19,20)(H,21,22)/b9-6+ |
| InChIKey | KYXJKIJBAORZFC-RMKNXTFCSA-N |
| XLogP | 4.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|