C21H23N3O2S2 — CID 4505182
2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 4505182) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4505182 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | CC(C)c1ccc(C=CC(=O)NC(=S)Nc2sc3c(c2C(N)=O)CCC3)cc1 |
| InChI | InChI=1S/C21H23N3O2S2/c1-12(2)14-9-6-13(7-10-14)8-11-17(25)23-21(27)24-20-18(19(22)26)15-4-3-5-16(15)28-20/h6-12H,3-5H2,1-2H3,(H2,22,26)(H2,23,24,25,27) |
| InChIKey | PDECCWAFPJXXHD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|