C19H22N2O2S — CID 3541829
4,5-dimethyl-2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]thiophene-3-carboxamide (PubChem CID 3541829) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 4,5-dimethyl-2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]thiophene-3-carboxamide.
| Compound Name | 4,5-dimethyl-2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3541829 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4,5-dimethyl-2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]thiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)C=Cc2ccc(C(C)C)cc2)c(C(N)=O)c1C |
| InChI | InChI=1S/C19H22N2O2S/c1-11(2)15-8-5-14(6-9-15)7-10-16(22)21-19-17(18(20)23)12(3)13(4)24-19/h5-11H,1-4H3,(H2,20,23)(H,21,22) |
| InChIKey | YFTMKHASVRAHIW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|