C11H11N2O4S- — CID 4746491
4-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-4-oxobut-2-enoate (PubChem CID 4746491) has the molecular formula C11H11N2O4S- and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-4-oxobut-2-enoate.
| Compound Name | 4-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4746491 |
| Molecular Formula | C11H11N2O4S- |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-4-oxobut-2-enoate |
| SMILES | Cc1sc(NC(=O)C=CC(=O)[O-])c(C(N)=O)c1C |
| InChI | InChI=1S/C11H12N2O4S/c1-5-6(2)18-11(9(5)10(12)17)13-7(14)3-4-8(15)16/h3-4H,1-2H3,(H2,12,17)(H,13,14)(H,15,16)/p-1 |
| InChIKey | MRGWOYCRVOQUSV-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|