C12H11N2O4S- — CID 7303293
(E)-4-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-4-oxobut-2-enoate (PubChem CID 7303293) has the molecular formula C12H11N2O4S- and a molecular weight of 279.30 g/mol. Its IUPAC name is (E)-4-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7303293 |
| Molecular Formula | C12H11N2O4S- |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | (E)-4-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-4-oxobut-2-enoate |
| SMILES | NC(=O)c1c(NC(=O)/C=C/C(=O)[O-])sc2c1CCC2 |
| InChI | InChI=1S/C12H12N2O4S/c13-11(18)10-6-2-1-3-7(6)19-12(10)14-8(15)4-5-9(16)17/h4-5H,1-3H2,(H2,13,18)(H,14,15)(H,16,17)/p-1/b5-4+ |
| InChIKey | IBRIYRXUASBBOC-SNAWJCMRSA-M |
| XLogP | -0.42 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|