C12H15N2O4S- — CID 7741576
5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-5-oxopentanoate (PubChem CID 7741576) has the molecular formula C12H15N2O4S- and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-5-oxopentanoate.
| Compound Name | 5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 7741576 |
| Molecular Formula | C12H15N2O4S- |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)amino]-5-oxopentanoate |
| SMILES | Cc1sc(NC(=O)CCCC(=O)[O-])c(C(N)=O)c1C |
| InChI | InChI=1S/C12H16N2O4S/c1-6-7(2)19-12(10(6)11(13)18)14-8(15)4-3-5-9(16)17/h3-5H2,1-2H3,(H2,13,18)(H,14,15)(H,16,17)/p-1 |
| InChIKey | CZHCEXOGLLRKRR-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |