C23H23N3O3S — CID 56500894
2-[(3-benzamido-3-phenylpropanoyl)amino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 56500894) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[(3-benzamido-3-phenylpropanoyl)amino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[(3-benzamido-3-phenylpropanoyl)amino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 56500894 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[(3-benzamido-3-phenylpropanoyl)amino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)CC(NC(=O)c2ccccc2)c2ccccc2)c(C(N)=O)c1C |
| InChI | InChI=1S/C23H23N3O3S/c1-14-15(2)30-23(20(14)21(24)28)26-19(27)13-18(16-9-5-3-6-10-16)25-22(29)17-11-7-4-8-12-17/h3-12,18H,13H2,1-2H3,(H2,24,28)(H,25,29)(H,26,27) |
| InChIKey | AWBMRUCWUKNVHC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |