C20H18FN3O2S — CID 4075749
4-(4-fluorophenyl)-5-methyl-2-[(4-methylphenyl)carbamoylamino]thiophene-3-carboxamide (PubChem CID 4075749) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-methyl-2-[(4-methylphenyl)carbamoylamino]thiophene-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-5-methyl-2-[(4-methylphenyl)carbamoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4075749 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-(4-fluorophenyl)-5-methyl-2-[(4-methylphenyl)carbamoylamino]thiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2sc(C)c(-c3ccc(F)cc3)c2C(N)=O)cc1 |
| InChI | InChI=1S/C20H18FN3O2S/c1-11-3-9-15(10-4-11)23-20(26)24-19-17(18(22)25)16(12(2)27-19)13-5-7-14(21)8-6-13/h3-10H,1-2H3,(H2,22,25)(H2,23,24,26) |
| InChIKey | ZZOHHAXEBJGVFJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |