C14H10BrN3O2S — CID 2726172
2-(4-bromophenyl)sulfanyl-4,6-dimethyl-5-nitropyridine-3-carbonitrile (PubChem CID 2726172) has the molecular formula C14H10BrN3O2S and a molecular weight of 364.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-4,6-dimethyl-5-nitropyridine-3-carbonitrile.
| Compound Name | 2-(4-bromophenyl)sulfanyl-4,6-dimethyl-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 2726172 |
| Molecular Formula | C14H10BrN3O2S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-4,6-dimethyl-5-nitropyridine-3-carbonitrile |
| SMILES | Cc1nc(Sc2ccc(Br)cc2)c(C#N)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10BrN3O2S/c1-8-12(7-16)14(17-9(2)13(8)18(19)20)21-11-5-3-10(15)4-6-11/h3-6H,1-2H3 |
| InChIKey | ZVKRQQLIVGVTJW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|