C24H18N2O2S2 — CID 163347744
N-(2-phenacylsulfanyl-4-phenyl-1,3-thiazol-5-yl)benzamide (PubChem CID 163347744) has the molecular formula C24H18N2O2S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-(2-phenacylsulfanyl-4-phenyl-1,3-thiazol-5-yl)benzamide.
| Compound Name | N-(2-phenacylsulfanyl-4-phenyl-1,3-thiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 163347744 |
| Molecular Formula | C24H18N2O2S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-(2-phenacylsulfanyl-4-phenyl-1,3-thiazol-5-yl)benzamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)c(NC(=O)c2ccccc2)s1)c1ccccc1 |
| InChI | InChI=1S/C24H18N2O2S2/c27-20(17-10-4-1-5-11-17)16-29-24-25-21(18-12-6-2-7-13-18)23(30-24)26-22(28)19-14-8-3-9-15-19/h1-15H,16H2,(H,26,28) |
| InChIKey | KBDZWNPXVHWMSC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |