C12H11N7O2 — CID 135479905
7-amino-8-[(4-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a][1,3,5]triazine-2,4-dione (PubChem CID 135479905) has the molecular formula C12H11N7O2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 7-amino-8-[(4-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a][1,3,5]triazine-2,4-dione.
| Compound Name | 7-amino-8-[(4-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 135479905 |
| Molecular Formula | C12H11N7O2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 7-amino-8-[(4-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a][1,3,5]triazine-2,4-dione |
| SMILES | Cc1ccc(/N=N/c2c(N)nn3c(=O)[nH]c(=O)[nH]c23)cc1 |
| InChI | InChI=1S/C12H11N7O2/c1-6-2-4-7(5-3-6)16-17-8-9(13)18-19-10(8)14-11(20)15-12(19)21/h2-5H,1H3,(H2,13,18)(H2,14,15,20,21)/b17-16+ |
| InChIKey | NWWCQGIQGMIYJB-WUKNDPDISA-N |
| XLogP | 1.02 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|