C15H16N6O — CID 135479121
2-amino-3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 135479121) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-4H-pyrazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 2-amino-3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 135479121 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-amino-3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | Cc1ccc(/N=N/c2c(N)nn3c(C)cc(=O)[nH]c23)c(C)c1 |
| InChI | InChI=1S/C15H16N6O/c1-8-4-5-11(9(2)6-8)18-19-13-14(16)20-21-10(3)7-12(22)17-15(13)21/h4-7H,1-3H3,(H2,16,20)(H,17,22)/b19-18+ |
| InChIKey | QGZJSGPFLHPSKN-VHEBQXMUSA-N |
| XLogP | 2.95 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|