C14H14N6O — CID 135482837
2-amino-7-methyl-3-[(4-methylphenyl)diazenyl]-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 135482837) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-amino-7-methyl-3-[(4-methylphenyl)diazenyl]-4H-pyrazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 2-amino-7-methyl-3-[(4-methylphenyl)diazenyl]-4H-pyrazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 135482837 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-amino-7-methyl-3-[(4-methylphenyl)diazenyl]-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | Cc1ccc(/N=N/c2c(N)nn3c(C)cc(=O)[nH]c23)cc1 |
| InChI | InChI=1S/C14H14N6O/c1-8-3-5-10(6-4-8)17-18-12-13(15)19-20-9(2)7-11(21)16-14(12)20/h3-7H,1-2H3,(H2,15,19)(H,16,21)/b18-17+ |
| InChIKey | FUNWVQRLQHFWGF-ISLYRVAYSA-N |
| XLogP | 2.64 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|