C13H16N6O2 — CID 1494811
1-[3,5-diamino-4-[(4-ethoxyphenyl)diazenyl]pyrazol-1-yl]ethanone (PubChem CID 1494811) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[3,5-diamino-4-[(4-ethoxyphenyl)diazenyl]pyrazol-1-yl]ethanone.
| Compound Name | 1-[3,5-diamino-4-[(4-ethoxyphenyl)diazenyl]pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 1494811 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[3,5-diamino-4-[(4-ethoxyphenyl)diazenyl]pyrazol-1-yl]ethanone |
| SMILES | CCOc1ccc(/N=N/c2c(N)nn(C(C)=O)c2N)cc1 |
| InChI | InChI=1S/C13H16N6O2/c1-3-21-10-6-4-9(5-7-10)16-17-11-12(14)18-19(8(2)20)13(11)15/h4-7H,3,15H2,1-2H3,(H2,14,18)/b17-16+ |
| InChIKey | FKBDSAMOEBMMLD-WUKNDPDISA-N |
| XLogP | 2.52 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|