C17H19N7O3 — CID 135431483
ethyl 2,7-diamino-3-[(4-ethoxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135431483) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is ethyl 2,7-diamino-3-[(4-ethoxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2,7-diamino-3-[(4-ethoxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135431483 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl 2,7-diamino-3-[(4-ethoxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(/N=N/c3ccc(OCC)cc3)c(N)nn2c1N |
| InChI | InChI=1S/C17H19N7O3/c1-3-26-11-7-5-10(6-8-11)21-22-13-14(18)23-24-15(19)12(9-20-16(13)24)17(25)27-4-2/h5-9H,3-4,19H2,1-2H3,(H2,18,23)/b22-21+ |
| InChIKey | HSGIFJVRCQJVQV-QURGRASLSA-N |
| XLogP | 2.88 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|