C20H21N5O4 — CID 50743577
ethyl 5-amino-1-[5-[(4-ethoxyphenyl)carbamoyl]-2-pyridinyl]pyrazole-4-carboxylate (PubChem CID 50743577) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is ethyl 5-amino-1-[5-[(4-ethoxyphenyl)carbamoyl]-2-pyridinyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-[5-[(4-ethoxyphenyl)carbamoyl]-2-pyridinyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 50743577 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | ethyl 5-amino-1-[5-[(4-ethoxyphenyl)carbamoyl]-2-pyridinyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)Nc3ccc(OCC)cc3)cn2)c1N |
| InChI | InChI=1S/C20H21N5O4/c1-3-28-15-8-6-14(7-9-15)24-19(26)13-5-10-17(22-11-13)25-18(21)16(12-23-25)20(27)29-4-2/h5-12H,3-4,21H2,1-2H3,(H,24,26) |
| InChIKey | DJYPXWYZTVDESE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |