C16H12F3N7O — CID 1494797
[3,5-diamino-4-[[2-(trifluoromethyl)phenyl]diazenyl]pyrazol-1-yl]-pyridin-4-ylmethanone (PubChem CID 1494797) has the molecular formula C16H12F3N7O and a molecular weight of 375.31 g/mol. Its IUPAC name is [3,5-diamino-4-[[2-(trifluoromethyl)phenyl]diazenyl]pyrazol-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [3,5-diamino-4-[[2-(trifluoromethyl)phenyl]diazenyl]pyrazol-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 1494797 |
| Molecular Formula | C16H12F3N7O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [3,5-diamino-4-[[2-(trifluoromethyl)phenyl]diazenyl]pyrazol-1-yl]-pyridin-4-ylmethanone |
| SMILES | Nc1nn(C(=O)c2ccncc2)c(N)c1/N=N/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N7O/c17-16(18,19)10-3-1-2-4-11(10)23-24-12-13(20)25-26(14(12)21)15(27)9-5-7-22-8-6-9/h1-8H,21H2,(H2,20,25)/b24-23+ |
| InChIKey | IEFHORCAFCCUIM-WCWDXBQESA-N |
| XLogP | 3.57 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|