C27H18ClN5O — CID 10253862
[4-[(2-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-pyridin-4-ylmethanone (PubChem CID 10253862) has the molecular formula C27H18ClN5O and a molecular weight of 463.93 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-[(2-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 10253862 |
| Molecular Formula | C27H18ClN5O |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [4-[(2-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)n1nc(-c2ccccc2)c(/N=N/c2ccccc2Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C27H18ClN5O/c28-22-13-7-8-14-23(22)30-31-25-24(19-9-3-1-4-10-19)32-33(26(25)20-11-5-2-6-12-20)27(34)21-15-17-29-18-16-21/h1-18H/b31-30+ |
| InChIKey | BLCUURJPJLTZET-NVQSTNCTSA-N |
| XLogP | 7.37 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|