C14H11N5O — CID 71253732
(5-amino-3-pyridin-4-yl-1,2,4-triazol-1-yl)-phenylmethanone (PubChem CID 71253732) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is (5-amino-3-pyridin-4-yl-1,2,4-triazol-1-yl)-phenylmethanone.
| Compound Name | (5-amino-3-pyridin-4-yl-1,2,4-triazol-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 71253732 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (5-amino-3-pyridin-4-yl-1,2,4-triazol-1-yl)-phenylmethanone |
| SMILES | Nc1nc(-c2ccncc2)nn1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H11N5O/c15-14-17-12(10-6-8-16-9-7-10)18-19(14)13(20)11-4-2-1-3-5-11/h1-9H,(H2,15,17,18) |
| InChIKey | HPBCTRCLXUKZBM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |