C21H15F3N2O — CID 91209141
1,2-diphenyl-2-[[2-(trifluoromethyl)phenyl]diazenyl]ethanone (PubChem CID 91209141) has the molecular formula C21H15F3N2O and a molecular weight of 368.36 g/mol. Its IUPAC name is 1,2-diphenyl-2-[[2-(trifluoromethyl)phenyl]diazenyl]ethanone.
| Compound Name | 1,2-diphenyl-2-[[2-(trifluoromethyl)phenyl]diazenyl]ethanone |
|---|---|
| PubChem CID | 91209141 |
| Molecular Formula | C21H15F3N2O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1,2-diphenyl-2-[[2-(trifluoromethyl)phenyl]diazenyl]ethanone |
| SMILES | O=C(c1ccccc1)C(/N=N/c1ccccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H15F3N2O/c22-21(23,24)17-13-7-8-14-18(17)25-26-19(15-9-3-1-4-10-15)20(27)16-11-5-2-6-12-16/h1-14,19H/b26-25+ |
| InChIKey | LJBUUWJAFOMGMP-OCEACIFDSA-N |
| XLogP | 6.41 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|