C46H46ClN9 — CID 162147029
3-[(4-chlorophenyl)diazenyl]-4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,6-diamine;4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,3,6-triamine (PubChem CID 162147029) has the molecular formula C46H46ClN9 and a molecular weight of 760.39 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)diazenyl]-4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,6-diamine;4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,3,6-triamine.
| Compound Name | 3-[(4-chlorophenyl)diazenyl]-4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,6-diamine;4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 162147029 |
| Molecular Formula | C46H46ClN9 |
| Molecular Weight | 760.39 g/mol |
| Exact Mass | 759.36 |
| IUPAC Name | 3-[(4-chlorophenyl)diazenyl]-4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,6-diamine;4-[1-(3-methylphenyl)-2-phenylethyl]pyridine-2,3,6-triamine |
| SMILES | Cc1cccc(C(Cc2ccccc2)c2cc(N)nc(N)c2/N=N/c2ccc(Cl)cc2)c1.Cc1cccc(C(Cc2ccccc2)c2cc(N)nc(N)c2N)c1 |
| InChI | InChI=1S/C26H24ClN5.C20H22N4/c1-17-6-5-9-19(14-17)22(15-18-7-3-2-4-8-18)23-16-24(28)30-26(29)25(23)32-31-21-12-10-20(27)11-13-21;1-13-6-5-9-15(10-13)16(11-14-7-3-2-4-8-14)17-12-18(21)24-20(23)19(17)22/h2-14,16,22H,15H2,1H3,(H4,28,29,30);2-10,12,16H,11,22H2,1H3,(H4,21,23,24)/b32-31+; |
| InChIKey | ZKRPHIHOARNVDY-MRRLHAJBSA-N |
| XLogP | 10.51 |
| TPSA | 180.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.39 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|