C20H19N5O — CID 130432010
7-[1-(3-methoxyphenyl)-2-phenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 130432010) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 7-[1-(3-methoxyphenyl)-2-phenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[1-(3-methoxyphenyl)-2-phenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 130432010 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 7-[1-(3-methoxyphenyl)-2-phenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | COc1cccc(C(Cc2ccccc2)c2cc(N)nc3n[nH]nc23)c1 |
| InChI | InChI=1S/C20H19N5O/c1-26-15-9-5-8-14(11-15)16(10-13-6-3-2-4-7-13)17-12-18(21)22-20-19(17)23-25-24-20/h2-9,11-12,16H,10H2,1H3,(H3,21,22,23,24,25) |
| InChIKey | SWBQZMPOXOLVQS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |