C21H24N2O — CID 143272438
methane;6-[1-(4-methoxyphenyl)-2-phenylethyl]pyridin-2-amine (PubChem CID 143272438) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is methane;6-[1-(4-methoxyphenyl)-2-phenylethyl]pyridin-2-amine.
| Compound Name | methane;6-[1-(4-methoxyphenyl)-2-phenylethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 143272438 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | methane;6-[1-(4-methoxyphenyl)-2-phenylethyl]pyridin-2-amine |
| SMILES | C.COc1ccc(C(Cc2ccccc2)c2cccc(N)n2)cc1 |
| InChI | InChI=1S/C20H20N2O.CH4/c1-23-17-12-10-16(11-13-17)18(14-15-6-3-2-4-7-15)19-8-5-9-20(21)22-19;/h2-13,18H,14H2,1H3,(H2,21,22);1H4 |
| InChIKey | DJDOUJNLKZGMCT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |