C21H22N2O2 — CID 11551734
[5-[1-(6-amino-2-pyridinyl)-2-phenylethyl]-2-methoxyphenyl]methanol (PubChem CID 11551734) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [5-[1-(6-amino-2-pyridinyl)-2-phenylethyl]-2-methoxyphenyl]methanol.
| Compound Name | [5-[1-(6-amino-2-pyridinyl)-2-phenylethyl]-2-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 11551734 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | [5-[1-(6-amino-2-pyridinyl)-2-phenylethyl]-2-methoxyphenyl]methanol |
| SMILES | COc1ccc(C(Cc2ccccc2)c2cccc(N)n2)cc1CO |
| InChI | InChI=1S/C21H22N2O2/c1-25-20-11-10-16(13-17(20)14-24)18(12-15-6-3-2-4-7-15)19-8-5-9-21(22)23-19/h2-11,13,18,24H,12,14H2,1H3,(H2,22,23) |
| InChIKey | VCEOSZIMQWGMMC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |