C25H35N7O — CID 145371687
N,N-dimethylformamide;6-hydrazinyl-4-[3-[(3-methylphenyl)methylamino]-1-phenylpropyl]pyridine-2,5-diamine (PubChem CID 145371687) has the molecular formula C25H35N7O and a molecular weight of 449.60 g/mol. Its IUPAC name is N,N-dimethylformamide;6-hydrazinyl-4-[3-[(3-methylphenyl)methylamino]-1-phenylpropyl]pyridine-2,5-diamine.
| Compound Name | N,N-dimethylformamide;6-hydrazinyl-4-[3-[(3-methylphenyl)methylamino]-1-phenylpropyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 145371687 |
| Molecular Formula | C25H35N7O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | N,N-dimethylformamide;6-hydrazinyl-4-[3-[(3-methylphenyl)methylamino]-1-phenylpropyl]pyridine-2,5-diamine |
| SMILES | CN(C)C=O.Cc1cccc(CNCCC(c2ccccc2)c2cc(N)nc(NN)c2N)c1 |
| InChI | InChI=1S/C22H28N6.C3H7NO/c1-15-6-5-7-16(12-15)14-26-11-10-18(17-8-3-2-4-9-17)19-13-20(23)27-22(28-25)21(19)24;1-4(2)3-5/h2-9,12-13,18,26H,10-11,14,24-25H2,1H3,(H3,23,27,28);3H,1-2H3 |
| InChIKey | IMPVBHYITXKACO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|