C22H24F3N5 — CID 145371800
4-[1-phenyl-3-[[4-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-2,3,6-triamine (PubChem CID 145371800) has the molecular formula C22H24F3N5 and a molecular weight of 415.46 g/mol. Its IUPAC name is 4-[1-phenyl-3-[[4-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-2,3,6-triamine.
| Compound Name | 4-[1-phenyl-3-[[4-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 145371800 |
| Molecular Formula | C22H24F3N5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-[1-phenyl-3-[[4-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-2,3,6-triamine |
| SMILES | Nc1cc(C(CCNCc2ccc(C(F)(F)F)cc2)c2ccccc2)c(N)c(N)n1 |
| InChI | InChI=1S/C22H24F3N5/c23-22(24,25)16-8-6-14(7-9-16)13-29-11-10-17(15-4-2-1-3-5-15)18-12-19(26)30-21(28)20(18)27/h1-9,12,17,29H,10-11,13,27H2,(H4,26,28,30) |
| InChIKey | GUTQSXYSGFQTDO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|