C24H31N7O — CID 155112963
3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 155112963) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is 3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 155112963 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(CNCCC(c2ccccc2)c2cc(N)nc(NN)c2N)c1 |
| InChI | InChI=1S/C24H31N7O/c1-31(2)24(32)18-10-6-7-16(13-18)15-28-12-11-19(17-8-4-3-5-9-17)20-14-21(25)29-23(30-27)22(20)26/h3-10,13-14,19,28H,11-12,15,26-27H2,1-2H3,(H3,25,29,30) |
| InChIKey | LGJSUFMHXKHTCG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|