C22H27N7O — CID 145371690
3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]benzamide (PubChem CID 145371690) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]benzamide.
| Compound Name | 3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 145371690 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[[[3-(3,6-diamino-2-hydrazinyl-4-pyridinyl)-3-phenylpropyl]amino]methyl]benzamide |
| SMILES | NNc1nc(N)cc(C(CCNCc2cccc(C(N)=O)c2)c2ccccc2)c1N |
| InChI | InChI=1S/C22H27N7O/c23-19-12-18(20(24)22(28-19)29-26)17(15-6-2-1-3-7-15)9-10-27-13-14-5-4-8-16(11-14)21(25)30/h1-8,11-12,17,27H,9-10,13,24,26H2,(H2,25,30)(H3,23,28,29) |
| InChIKey | ICRPWQFIBSYWMI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 158.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|