C17H13F3N2O — CID 45484940
5-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-3-amine (PubChem CID 45484940) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 5-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-3-amine.
| Compound Name | 5-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 45484940 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1,2-oxazol-3-amine |
| SMILES | FC(F)(F)c1ccc(CNc2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C17H13F3N2O/c18-17(19,20)14-8-6-12(7-9-14)11-21-16-10-15(23-22-16)13-4-2-1-3-5-13/h1-10H,11H2,(H,21,22) |
| InChIKey | LTIRKVNXSIMJQL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |