C17H11F3N2O2 — CID 154291859
2-[5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]benzamide (PubChem CID 154291859) has the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is 2-[5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]benzamide.
| Compound Name | 2-[5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 154291859 |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]benzamide |
| SMILES | NC(=O)c1ccccc1-c1cc(-c2ccc(C(F)(F)F)cc2)on1 |
| InChI | InChI=1S/C17H11F3N2O2/c18-17(19,20)11-7-5-10(6-8-11)15-9-14(22-24-15)12-3-1-2-4-13(12)16(21)23/h1-9H,(H2,21,23) |
| InChIKey | NLMLWQBVHARTSU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |