C21H24N4O — CID 145371683
4-(1-phenyl-3-phenylmethoxypropyl)pyridine-2,3,6-triamine (PubChem CID 145371683) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-(1-phenyl-3-phenylmethoxypropyl)pyridine-2,3,6-triamine.
| Compound Name | 4-(1-phenyl-3-phenylmethoxypropyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 145371683 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-(1-phenyl-3-phenylmethoxypropyl)pyridine-2,3,6-triamine |
| SMILES | Nc1cc(C(CCOCc2ccccc2)c2ccccc2)c(N)c(N)n1 |
| InChI | InChI=1S/C21H24N4O/c22-19-13-18(20(23)21(24)25-19)17(16-9-5-2-6-10-16)11-12-26-14-15-7-3-1-4-8-15/h1-10,13,17H,11-12,14,23H2,(H4,22,24,25) |
| InChIKey | GJQHJXJMHKWGIM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|