C32H34N6 — CID 155099338
7-[1-phenyl-3-[[2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 155099338) has the molecular formula C32H34N6 and a molecular weight of 502.67 g/mol. Its IUPAC name is 7-[1-phenyl-3-[[2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[1-phenyl-3-[[2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 155099338 |
| Molecular Formula | C32H34N6 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 7-[1-phenyl-3-[[2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(C(CCNCc2ccccc2Cc2ccc3c(c2)CCCC3)c2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C32H34N6/c33-30-20-29(31-32(35-30)37-38-36-31)28(24-9-2-1-3-10-24)16-17-34-21-27-13-7-6-12-26(27)19-22-14-15-23-8-4-5-11-25(23)18-22/h1-3,6-7,9-10,12-15,18,20,28,34H,4-5,8,11,16-17,19,21H2,(H3,33,35,36,37,38) |
| InChIKey | UFRNMTWJKPGFMQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|