C33H36N4 — CID 130431684
N-benzyl-3-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-3-phenylpropan-1-amine (PubChem CID 130431684) has the molecular formula C33H36N4 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-benzyl-3-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-3-phenylpropan-1-amine.
| Compound Name | N-benzyl-3-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 130431684 |
| Molecular Formula | C33H36N4 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | N-benzyl-3-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-3-phenylpropan-1-amine |
| SMILES | Cc1ccc(C)n1-c1cc(C(CCNCc2ccccc2)c2ccccc2)cc(-n2c(C)ccc2C)n1 |
| InChI | InChI=1S/C33H36N4/c1-24-15-16-25(2)36(24)32-21-30(22-33(35-32)37-26(3)17-18-27(37)4)31(29-13-9-6-10-14-29)19-20-34-23-28-11-7-5-8-12-28/h5-18,21-22,31,34H,19-20,23H2,1-4H3 |
| InChIKey | ZUKQTQUDUZDJGD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|