C26H28N4O2 — CID 130431764
[2-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-2-phenylethyl]carbamic acid (PubChem CID 130431764) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is [2-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-2-phenylethyl]carbamic acid.
| Compound Name | [2-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-2-phenylethyl]carbamic acid |
|---|---|
| PubChem CID | 130431764 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [2-[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-2-phenylethyl]carbamic acid |
| SMILES | Cc1ccc(C)n1-c1cc(C(CNC(=O)O)c2ccccc2)cc(-n2c(C)ccc2C)n1 |
| InChI | InChI=1S/C26H28N4O2/c1-17-10-11-18(2)29(17)24-14-22(15-25(28-24)30-19(3)12-13-20(30)4)23(16-27-26(31)32)21-8-6-5-7-9-21/h5-15,23,27H,16H2,1-4H3,(H,31,32) |
| InChIKey | RYNCIHYXEYTVIZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|