C13H14ClN5 — CID 126679434
3-[(4-chlorophenyl)diazenyl]-4-ethylpyridine-2,6-diamine (PubChem CID 126679434) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)diazenyl]-4-ethylpyridine-2,6-diamine.
| Compound Name | 3-[(4-chlorophenyl)diazenyl]-4-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 126679434 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[(4-chlorophenyl)diazenyl]-4-ethylpyridine-2,6-diamine |
| SMILES | CCc1cc(N)nc(N)c1/N=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN5/c1-2-8-7-11(15)17-13(16)12(8)19-18-10-5-3-9(14)4-6-10/h3-7H,2H2,1H3,(H4,15,16,17)/b19-18+ |
| InChIKey | FFKLXVNUUXOCIQ-VHEBQXMUSA-N |
| XLogP | 3.88 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|