C16H22BN5O2 — CID 147025997
6-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 147025997) has the molecular formula C16H22BN5O2 and a molecular weight of 327.20 g/mol. Its IUPAC name is 6-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 147025997 |
| Molecular Formula | C16H22BN5O2 |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 6-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)OB(Cc2cccc(-c3nc(N)nc(N)n3)c2)OC1(C)C |
| InChI | InChI=1S/C16H22BN5O2/c1-15(2)16(3,4)24-17(23-15)9-10-6-5-7-11(8-10)12-20-13(18)22-14(19)21-12/h5-8H,9H2,1-4H3,(H4,18,19,20,21,22) |
| InChIKey | AWQWNUHXHPBFIE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|