C13H10N2O4 — CID 82556241
6-amino-5-(3-carboxyphenyl)pyridine-2-carboxylic acid (PubChem CID 82556241) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 6-amino-5-(3-carboxyphenyl)pyridine-2-carboxylic acid.
| Compound Name | 6-amino-5-(3-carboxyphenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 82556241 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 6-amino-5-(3-carboxyphenyl)pyridine-2-carboxylic acid |
| SMILES | Nc1nc(C(=O)O)ccc1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H10N2O4/c14-11-9(4-5-10(15-11)13(18)19)7-2-1-3-8(6-7)12(16)17/h1-6H,(H2,14,15)(H,16,17)(H,18,19) |
| InChIKey | GJCGAFQPZJCBSY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |