C43H29N5O — CID 155049877
2-[3-[2-(4,6-diphenylpyrimidin-2-yl)phenoxy]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 155049877) has the molecular formula C43H29N5O and a molecular weight of 631.74 g/mol. Its IUPAC name is 2-[3-[2-(4,6-diphenylpyrimidin-2-yl)phenoxy]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[2-(4,6-diphenylpyrimidin-2-yl)phenoxy]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155049877 |
| Molecular Formula | C43H29N5O |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 2-[3-[2-(4,6-diphenylpyrimidin-2-yl)phenoxy]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3Oc3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C43H29N5O/c1-5-16-30(17-6-1)37-29-38(31-18-7-2-8-19-31)45-43(44-37)36-26-13-14-27-39(36)49-35-25-15-24-34(28-35)42-47-40(32-20-9-3-10-21-32)46-41(48-42)33-22-11-4-12-23-33/h1-29H |
| InChIKey | PWLQCMRKSANUMI-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |