C55H38N6O4 — CID 58299083
2-[[4,6-bis(3-phenoxyphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3-phenoxyphenyl)-1,3,5-triazine (PubChem CID 58299083) has the molecular formula C55H38N6O4 and a molecular weight of 846.95 g/mol. Its IUPAC name is 2-[[4,6-bis(3-phenoxyphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3-phenoxyphenyl)-1,3,5-triazine.
| Compound Name | 2-[[4,6-bis(3-phenoxyphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3-phenoxyphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58299083 |
| Molecular Formula | C55H38N6O4 |
| Molecular Weight | 846.95 g/mol |
| Exact Mass | 846.30 |
| IUPAC Name | 2-[[4,6-bis(3-phenoxyphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3-phenoxyphenyl)-1,3,5-triazine |
| SMILES | c1ccc(Oc2cccc(-c3nc(Cc4nc(-c5cccc(Oc6ccccc6)c5)nc(-c5cccc(Oc6ccccc6)c5)n4)nc(-c4cccc(Oc5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C55H38N6O4/c1-5-21-42(22-6-1)62-46-29-13-17-38(33-46)52-56-50(57-53(60-52)39-18-14-30-47(34-39)63-43-23-7-2-8-24-43)37-51-58-54(40-19-15-31-48(35-40)64-44-25-9-3-10-26-44)61-55(59-51)41-20-16-32-49(36-41)65-45-27-11-4-12-28-45/h1-36H,37H2 |
| InChIKey | UIYMKYQUGPRWIZ-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.95 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |